C15H17N3 — CID 104531976
5-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridin-3-amine (PubChem CID 104531976) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridin-3-amine.
| Compound Name | 5-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 104531976 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridin-3-amine |
| SMILES | CC1CCc2ccccc2N1c1cncc(N)c1 |
| InChI | InChI=1S/C15H17N3/c1-11-6-7-12-4-2-3-5-15(12)18(11)14-8-13(16)9-17-10-14/h2-5,8-11H,6-7,16H2,1H3 |
| InChIKey | OVWFCXMEJPXPPL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |