C24H48O2Si — CID 10453377
(E)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-4-enal (PubChem CID 10453377) has the molecular formula C24H48O2Si and a molecular weight of 396.73 g/mol. Its IUPAC name is (E)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-4-enal.
| Compound Name | (E)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-4-enal |
|---|---|
| PubChem CID | 10453377 |
| Molecular Formula | C24H48O2Si |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (E)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-4-enal |
| SMILES | CCCCCCC(CCCCCC/C=C/CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O2Si/c1-7-8-9-17-20-23(26-27(5,6)24(2,3)4)21-18-15-13-11-10-12-14-16-19-22-25/h12,14,22-23H,7-11,13,15-21H2,1-6H3/b14-12+ |
| InChIKey | OXWUBPNMUCDDLH-WYMLVPIESA-N |
| XLogP | 8.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|