C23H44O2Si — CID 11068952
(7S)-7-tri(propan-2-yl)silyloxytetradeca-4,5-dienal (PubChem CID 11068952) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (7S)-7-tri(propan-2-yl)silyloxytetradeca-4,5-dienal.
| Compound Name | (7S)-7-tri(propan-2-yl)silyloxytetradeca-4,5-dienal |
|---|---|
| PubChem CID | 11068952 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (7S)-7-tri(propan-2-yl)silyloxytetradeca-4,5-dienal |
| SMILES | CCCCCCC[C@@H](C=C=CCCC=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H44O2Si/c1-8-9-10-11-14-17-23(18-15-12-13-16-19-24)25-26(20(2)3,21(4)5)22(6)7/h12,18-23H,8-11,13-14,16-17H2,1-7H3/t15?,23-/m0/s1 |
| InChIKey | ZLLUQLXHLZFMGJ-GMTBNIFVSA-N |
| XLogP | 7.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|