C14H14O3 — CID 104539655
3-(4-methylbenzoyl)cyclohexane-1,2-dione (PubChem CID 104539655) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(4-methylbenzoyl)cyclohexane-1,2-dione.
| Compound Name | 3-(4-methylbenzoyl)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 104539655 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-(4-methylbenzoyl)cyclohexane-1,2-dione |
| SMILES | Cc1ccc(C(=O)C2CCCC(=O)C2=O)cc1 |
| InChI | InChI=1S/C14H14O3/c1-9-5-7-10(8-6-9)13(16)11-3-2-4-12(15)14(11)17/h5-8,11H,2-4H2,1H3 |
| InChIKey | FRIZVILWJLERJT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|