C20H20ClFN2O2S — CID 10454045
6-chloro-3-(3-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)indole (PubChem CID 10454045) has the molecular formula C20H20ClFN2O2S and a molecular weight of 406.91 g/mol. Its IUPAC name is 6-chloro-3-(3-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)indole.
| Compound Name | 6-chloro-3-(3-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)indole |
|---|---|
| PubChem CID | 10454045 |
| Molecular Formula | C20H20ClFN2O2S |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 6-chloro-3-(3-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)indole |
| SMILES | O=S(=O)(c1cccc(F)c1)c1cn(CC2CCCCN2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H20ClFN2O2S/c21-14-7-8-18-19(10-14)24(12-16-5-1-2-9-23-16)13-20(18)27(25,26)17-6-3-4-15(22)11-17/h3-4,6-8,10-11,13,16,23H,1-2,5,9,12H2 |
| InChIKey | FNMHOFSZSKUBPE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |