C19H19ClFN3O2S — CID 22065935
6-chloro-3-(4-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)pyrrolo[3,2-c]pyridine (PubChem CID 22065935) has the molecular formula C19H19ClFN3O2S and a molecular weight of 407.90 g/mol. Its IUPAC name is 6-chloro-3-(4-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)pyrrolo[3,2-c]pyridine.
| Compound Name | 6-chloro-3-(4-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 22065935 |
| Molecular Formula | C19H19ClFN3O2S |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 6-chloro-3-(4-fluorophenyl)sulfonyl-1-(piperidin-2-ylmethyl)pyrrolo[3,2-c]pyridine |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1cn(CC2CCCCN2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C19H19ClFN3O2S/c20-19-9-17-16(10-23-19)18(12-24(17)11-14-3-1-2-8-22-14)27(25,26)15-6-4-13(21)5-7-15/h4-7,9-10,12,14,22H,1-3,8,11H2 |
| InChIKey | ODCYKFRQEQAALP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|