C13H11BrINOS — CID 104541568
(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(5-iodothiophen-3-yl)methanamine (PubChem CID 104541568) has the molecular formula C13H11BrINOS and a molecular weight of 436.11 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(5-iodothiophen-3-yl)methanamine.
| Compound Name | (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(5-iodothiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 104541568 |
| Molecular Formula | C13H11BrINOS |
| Molecular Weight | 436.11 g/mol |
| Exact Mass | 434.88 |
| IUPAC Name | (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(5-iodothiophen-3-yl)methanamine |
| SMILES | NC(c1csc(I)c1)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H11BrINOS/c14-9-3-7-1-2-17-13(7)10(5-9)12(16)8-4-11(15)18-6-8/h3-6,12H,1-2,16H2 |
| InChIKey | FADVUQWDUKZQBB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|