C17H17BrO3 — CID 104542962
(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(2-ethoxyphenyl)methanol (PubChem CID 104542962) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(2-ethoxyphenyl)methanol.
| Compound Name | (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(2-ethoxyphenyl)methanol |
|---|---|
| PubChem CID | 104542962 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (5-bromo-2,3-dihydro-1-benzofuran-7-yl)-(2-ethoxyphenyl)methanol |
| SMILES | CCOc1ccccc1C(O)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C17H17BrO3/c1-2-20-15-6-4-3-5-13(15)16(19)14-10-12(18)9-11-7-8-21-17(11)14/h3-6,9-10,16,19H,2,7-8H2,1H3 |
| InChIKey | BNSDYZSPDVYIPU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |