C23H37N3O2S — CID 10454784
1-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 10454784) has the molecular formula C23H37N3O2S and a molecular weight of 419.64 g/mol. Its IUPAC name is 1-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 10454784 |
| Molecular Formula | C23H37N3O2S |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCC2CCN(CC3CCCCC3)CC2)cc1OC |
| InChI | InChI=1S/C23H37N3O2S/c1-27-21-9-8-20(16-22(21)28-2)25-23(29)24-13-10-18-11-14-26(15-12-18)17-19-6-4-3-5-7-19/h8-9,16,18-19H,3-7,10-15,17H2,1-2H3,(H2,24,25,29) |
| InChIKey | LGJLDKOPFKVCJN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|