C16H20N2O — CID 104557410
2-(furan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)ethanamine (PubChem CID 104557410) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)ethanamine.
| Compound Name | 2-(furan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 104557410 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-(furan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)ethanamine |
| SMILES | c1coc(CCNCc2cccc3c2CCNC3)c1 |
| InChI | InChI=1S/C16H20N2O/c1-3-13(16-7-9-18-12-14(16)4-1)11-17-8-6-15-5-2-10-19-15/h1-5,10,17-18H,6-9,11-12H2 |
| InChIKey | AOLUTPCZMKRYRJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|