C12H23NO6 — CID 104563231
2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-aminooxolane-3-carboxylate (PubChem CID 104563231) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-aminooxolane-3-carboxylate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-aminooxolane-3-carboxylate |
|---|---|
| PubChem CID | 104563231 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-aminooxolane-3-carboxylate |
| SMILES | COCCOCCOCCOC(=O)C1COCC1N |
| InChI | InChI=1S/C12H23NO6/c1-15-2-3-16-4-5-17-6-7-19-12(14)10-8-18-9-11(10)13/h10-11H,2-9,13H2,1H3 |
| InChIKey | PAZYSGURTUOYIM-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|