About bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate
bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate (PubChem CID 142638372) has the molecular formula C16H28O9S
and a molecular weight of 396.46 g/mol. Its IUPAC name is bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate |
| PubChem CID | 142638372 |
| Molecular Formula | C16H28O9S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate |
| SMILES | COCCOCCOC(=O)C1CCSOC1C(=O)OCCOCCOC |
| InChI | InChI=1S/C16H28O9S/c1-19-4-6-21-8-10-23-15(17)13-3-12-26-25-14(13)16(18)24-11-9-22-7-5-20-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | SGJPNCZTOBCKGM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate?
The IUPAC name of bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate (CID 142638372) is bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate.
What is the SMILES notation for bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate?
The canonical SMILES for bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate is COCCOCCOC(=O)C1CCSOC1C(=O)OCCOCCOC.
What is the InChIKey of bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate?
The InChIKey is SGJPNCZTOBCKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O9S/c1-19-4-6-21-8-10-23-15(17)13-3-12-26-25-14(13)16(18)24-11-9-22-7-5-20-2/h13-14H,3-12H2,1-2H3.
What are the key properties of bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate?
bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate has a molecular weight of 396.46 g/mol, XLogP of 0.45, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2-methoxyethoxy)ethyl] oxathiane-5,6-dicarboxylate is sourced from PubChem (CID 142638372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).