About 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate
2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate (PubChem CID 104563241) has the molecular formula C13H25NO5
and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate |
| PubChem CID | 104563241 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate |
| SMILES | COCCOCCOCCOC(=O)C1CCCNC1 |
| InChI | InChI=1S/C13H25NO5/c1-16-5-6-17-7-8-18-9-10-19-13(15)12-3-2-4-14-11-12/h12,14H,2-11H2,1H3 |
| InChIKey | QPVMQOFQBDELRV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate (CID 104563241) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate is COCCOCCOCCOC(=O)C1CCCNC1.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate?
The InChIKey is QPVMQOFQBDELRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5/c1-16-5-6-17-7-8-18-9-10-19-13(15)12-3-2-4-14-11-12/h12,14H,2-11H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate has a molecular weight of 275.34 g/mol, XLogP of 0.21, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl piperidine-3-carboxylate is sourced from PubChem (CID 104563241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).