About bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate
bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate (PubChem CID 174731342) has the molecular formula C9H21BiN2O2S2
and a molecular weight of 462.39 g/mol. Its IUPAC name is bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate.
Molecular Properties
| Compound Name | bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate |
| PubChem CID | 174731342 |
| Molecular Formula | C9H21BiN2O2S2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCNC1.NC(=S)S.[BiH3] |
| InChI | InChI=1S/C8H15NO2.CH3NS2.Bi.3H/c1-2-11-8(10)7-4-3-5-9-6-7;2-1(3)4;;;;/h7,9H,2-6H2,1H3;(H3,2,3,4);;;; |
| InChIKey | URBIQGQWABEZHO-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate?
The IUPAC name of bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate (CID 174731342) is bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate.
What is the SMILES notation for bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate?
The canonical SMILES for bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate is CCOC(=O)C1CCCNC1.NC(=S)S.[BiH3].
What is the InChIKey of bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate?
The InChIKey is URBIQGQWABEZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.CH3NS2.Bi.3H/c1-2-11-8(10)7-4-3-5-9-6-7;2-1(3)4;;;;/h7,9H,2-6H2,1H3;(H3,2,3,4);;;;.
What are the key properties of bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate?
bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate has a molecular weight of 462.39 g/mol, XLogP of -0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;carbamodithioic acid;ethyl piperidine-3-carboxylate is sourced from PubChem (CID 174731342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).