C21H38N2O6 — CID 158843375
1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;ethyl (3R)-piperidine-3-carboxylate (PubChem CID 158843375) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;ethyl (3R)-piperidine-3-carboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;ethyl (3R)-piperidine-3-carboxylate |
|---|---|
| PubChem CID | 158843375 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;ethyl (3R)-piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1.CCOC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C13H23NO4.C8H15NO2/c1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4;1-2-11-8(10)7-4-3-5-9-6-7/h10H,5-9H2,1-4H3;7,9H,2-6H2,1H3/t10-;7-/m11/s1 |
| InChIKey | IYNJPGQWNACTNK-DEZAYANASA-N |
| XLogP | 2.75 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|