C20H44N2O4 — CID 141098708
ethane;ethyl (3R)-piperidine-3-carboxylate;(3R)-piperidine-3-carboxylic acid (PubChem CID 141098708) has the molecular formula C20H44N2O4 and a molecular weight of 376.58 g/mol. Its IUPAC name is ethane;ethyl (3R)-piperidine-3-carboxylate;(3R)-piperidine-3-carboxylic acid.
| Compound Name | ethane;ethyl (3R)-piperidine-3-carboxylate;(3R)-piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 141098708 |
| Molecular Formula | C20H44N2O4 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | ethane;ethyl (3R)-piperidine-3-carboxylate;(3R)-piperidine-3-carboxylic acid |
| SMILES | CC.CC.CC.CCOC(=O)[C@@H]1CCCNC1.O=C(O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C8H15NO2.C6H11NO2.3C2H6/c1-2-11-8(10)7-4-3-5-9-6-7;8-6(9)5-2-1-3-7-4-5;3*1-2/h7,9H,2-6H2,1H3;5,7H,1-4H2,(H,8,9);3*1-2H3/t7-;5-;;;/m11.../s1 |
| InChIKey | OLPBRRRQPOIJMT-DKIWRIFZSA-N |
| XLogP | 3.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |