C22H41ClO10 — CID 158595485
cyclopropanecarbonyl chloride;2-[2-(2-methoxyethoxy)ethoxy]ethanol;2-[2-(2-methoxyethoxy)ethoxy]ethyl cyclopropanecarboxylate (PubChem CID 158595485) has the molecular formula C22H41ClO10 and a molecular weight of 501.01 g/mol. Its IUPAC name is cyclopropanecarbonyl chloride;2-[2-(2-methoxyethoxy)ethoxy]ethanol;2-[2-(2-methoxyethoxy)ethoxy]ethyl cyclopropanecarboxylate.
| Compound Name | cyclopropanecarbonyl chloride;2-[2-(2-methoxyethoxy)ethoxy]ethanol;2-[2-(2-methoxyethoxy)ethoxy]ethyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 158595485 |
| Molecular Formula | C22H41ClO10 |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | cyclopropanecarbonyl chloride;2-[2-(2-methoxyethoxy)ethoxy]ethanol;2-[2-(2-methoxyethoxy)ethoxy]ethyl cyclopropanecarboxylate |
| SMILES | COCCOCCOCCO.COCCOCCOCCOC(=O)C1CC1.O=C(Cl)C1CC1 |
| InChI | InChI=1S/C11H20O5.C7H16O4.C4H5ClO/c1-13-4-5-14-6-7-15-8-9-16-11(12)10-2-3-10;1-9-4-5-11-7-6-10-3-2-8;5-4(6)3-1-2-3/h10H,2-9H2,1H3;8H,2-7H2,1H3;3H,1-2H2 |
| InChIKey | HUYZCNAPDKEOGJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|