C15H24O9 — CID 66984163
4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]cyclohexane-1,2-dicarboxylic acid (PubChem CID 66984163) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is 4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 66984163 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxycarbonyl]cyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(OCCOCCOCCO)C1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C15H24O9/c16-3-4-22-5-6-23-7-8-24-15(21)10-1-2-11(13(17)18)12(9-10)14(19)20/h10-12,16H,1-9H2,(H,17,18)(H,19,20) |
| InChIKey | ZAOHXQNUYUPHCL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|