C18H19Cl2N3S — CID 1045633
(5R)-5-(2,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione (PubChem CID 1045633) has the molecular formula C18H19Cl2N3S and a molecular weight of 380.34 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 1045633 |
| Molecular Formula | C18H19Cl2N3S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2Cl)NC(=S)N(c2ccc(C)c(C)c2)N1 |
| InChI | InChI=1S/C18H19Cl2N3S/c1-4-18(15-8-6-13(19)10-16(15)20)21-17(24)23(22-18)14-7-5-11(2)12(3)9-14/h5-10,22H,4H2,1-3H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | GVOXCGZITMTFMN-GOSISDBHSA-N |
| XLogP | 5.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|