C12H23NO6S — CID 104563590
2-formamido-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]butanoic acid (PubChem CID 104563590) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-formamido-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]butanoic acid.
| Compound Name | 2-formamido-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 104563590 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-formamido-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]butanoic acid |
| SMILES | COCCOCCOCCSCCC(NC=O)C(=O)O |
| InChI | InChI=1S/C12H23NO6S/c1-17-3-4-18-5-6-19-7-9-20-8-2-11(12(15)16)13-10-14/h10-11H,2-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | HXMZXKAOQONVNM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|