C13H26O4 — CID 104564712
2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylcyclohexan-1-ol (PubChem CID 104564712) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 104564712 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylcyclohexan-1-ol |
| SMILES | COCCOCCOC1C(C)CC(C)CC1O |
| InChI | InChI=1S/C13H26O4/c1-10-8-11(2)13(12(14)9-10)17-7-6-16-5-4-15-3/h10-14H,4-9H2,1-3H3 |
| InChIKey | KZMMMGLLLLYGSO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|