C14H28O3 — CID 112588812
3,5-dimethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexan-1-ol (PubChem CID 112588812) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 3,5-dimethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexan-1-ol.
| Compound Name | 3,5-dimethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 112588812 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3,5-dimethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexan-1-ol |
| SMILES | CC1CC(C)C(OCCOC(C)(C)C)C(O)C1 |
| InChI | InChI=1S/C14H28O3/c1-10-8-11(2)13(12(15)9-10)16-6-7-17-14(3,4)5/h10-13,15H,6-9H2,1-5H3 |
| InChIKey | YHFMLVGSNAFLDW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|