C14H29NO5 — CID 104564893
3-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 104564893) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 104564893 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | COCCOCCOCCNC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H29NO5/c1-13(2,12(16)17)14(3,4)15-6-7-19-10-11-20-9-8-18-5/h15H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | VWOVHLOEAXCLDS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|