C7H12F3NO3 — CID 79792013
3,3,3-trifluoro-2-(2-methoxyethylamino)-2-methylpropanoic acid (PubChem CID 79792013) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(2-methoxyethylamino)-2-methylpropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-(2-methoxyethylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79792013 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3,3,3-trifluoro-2-(2-methoxyethylamino)-2-methylpropanoic acid |
| SMILES | COCCNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3/c1-6(5(12)13,7(8,9)10)11-3-4-14-2/h11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | UBUCIBVNQBYPNN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|