C8H14F3NO5S — CID 79793191
3,3,3-trifluoro-2-(3-methoxypropylsulfonylamino)-2-methylpropanoic acid (PubChem CID 79793191) has the molecular formula C8H14F3NO5S and a molecular weight of 293.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-methoxypropylsulfonylamino)-2-methylpropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-(3-methoxypropylsulfonylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79793191 |
| Molecular Formula | C8H14F3NO5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-methoxypropylsulfonylamino)-2-methylpropanoic acid |
| SMILES | COCCCS(=O)(=O)NC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO5S/c1-7(6(13)14,8(9,10)11)12-18(15,16)5-3-4-17-2/h12H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | KNPRSMUZZPXXPY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|