C9H16F3NO3 — CID 104648495
3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid (PubChem CID 104648495) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104648495 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid |
| SMILES | COCCCCNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-8(7(14)15,9(10,11)12)13-5-3-4-6-16-2/h13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | ZKNFCYLOKLVQEM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|