3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid

C9H16F3NO3 — CID 104648495

IUPAC3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid
SMILESCOCCCCNC(C)(C(=O)O)C(F)(F)F
InChIInChI=1S/C9H16F3NO3/c1-8(7(14)15,9(10,11)12)13-5-3-4-6-16-2/h13H,3-6H2,1-2H3,(H,14,15)
InChIKeyZKNFCYLOKLVQEM-UHFFFAOYSA-N
MW243.22 g/mol
LogP1.41
Rot. Bonds7

About 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid

3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid (PubChem CID 104648495) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid.

Molecular Properties

Compound Name3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid
PubChem CID104648495
Molecular FormulaC9H16F3NO3
Molecular Weight243.22 g/mol
Exact Mass243.11
IUPAC Name3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid
SMILESCOCCCCNC(C)(C(=O)O)C(F)(F)F
InChIInChI=1S/C9H16F3NO3/c1-8(7(14)15,9(10,11)12)13-5-3-4-6-16-2/h13H,3-6H2,1-2H3,(H,14,15)
InChIKeyZKNFCYLOKLVQEM-UHFFFAOYSA-N
XLogP1.41
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid?
The IUPAC name of 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid (CID 104648495) is 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid.
What is the SMILES notation for 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid?
The canonical SMILES for 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid is COCCCCNC(C)(C(=O)O)C(F)(F)F.
What is the InChIKey of 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid?
The InChIKey is ZKNFCYLOKLVQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3/c1-8(7(14)15,9(10,11)12)13-5-3-4-6-16-2/h13H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid?
3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid has a molecular weight of 243.22 g/mol, XLogP of 1.41, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoro-2-(4-methoxybutylamino)-2-methylpropanoic acid is sourced from PubChem (CID 104648495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).