2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid

C8H14F3NO2 — CID 79791166

IUPAC2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid
SMILESCCCCNC(C)(C(=O)O)C(F)(F)F
InChIInChI=1S/C8H14F3NO2/c1-3-4-5-12-7(2,6(13)14)8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14)
InChIKeyCZAOOMPCCQCQBS-UHFFFAOYSA-N
MW213.20 g/mol
LogP1.78
Rot. Bonds5

About 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid

2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79791166) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid.

Molecular Properties

Compound Name2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid
PubChem CID79791166
Molecular FormulaC8H14F3NO2
Molecular Weight213.20 g/mol
Exact Mass213.10
IUPAC Name2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid
SMILESCCCCNC(C)(C(=O)O)C(F)(F)F
InChIInChI=1S/C8H14F3NO2/c1-3-4-5-12-7(2,6(13)14)8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14)
InChIKeyCZAOOMPCCQCQBS-UHFFFAOYSA-N
XLogP1.78
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.20
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The IUPAC name of 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid (CID 79791166) is 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid.
What is the SMILES notation for 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The canonical SMILES for 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid is CCCCNC(C)(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The InChIKey is CZAOOMPCCQCQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2/c1-3-4-5-12-7(2,6(13)14)8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid has a molecular weight of 213.20 g/mol, XLogP of 1.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid is sourced from PubChem (CID 79791166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).