C8H14F3NO2 — CID 79791166
2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79791166) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79791166 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(butylamino)-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CCCCNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-3-4-5-12-7(2,6(13)14)8(9,10)11/h12H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | CZAOOMPCCQCQBS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|