C8H11F6NO2 — CID 115514712
3,3,3-trifluoro-2-methyl-2-(4,4,4-trifluorobutylamino)propanoic acid (PubChem CID 115514712) has the molecular formula C8H11F6NO2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(4,4,4-trifluorobutylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(4,4,4-trifluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 115514712 |
| Molecular Formula | C8H11F6NO2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(4,4,4-trifluorobutylamino)propanoic acid |
| SMILES | CC(NCCCC(F)(F)F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO2/c1-6(5(16)17,8(12,13)14)15-4-2-3-7(9,10)11/h15H,2-4H2,1H3,(H,16,17) |
| InChIKey | POODRVJAUAJPSU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|