C16H24N2O3 — CID 104567532
[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indol-2-yl]methanamine (PubChem CID 104567532) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is [1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indol-2-yl]methanamine.
| Compound Name | [1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indol-2-yl]methanamine |
|---|---|
| PubChem CID | 104567532 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indol-2-yl]methanamine |
| SMILES | COCCOCCOCCn1c(CN)cc2ccccc21 |
| InChI | InChI=1S/C16H24N2O3/c1-19-8-9-21-11-10-20-7-6-18-15(13-17)12-14-4-2-3-5-16(14)18/h2-5,12H,6-11,13,17H2,1H3 |
| InChIKey | IPNLVRBAWDAFTI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|