C12H13F3N2S — CID 116627096
[1-[2-(trifluoromethylsulfanyl)ethyl]indol-2-yl]methanamine (PubChem CID 116627096) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is [1-[2-(trifluoromethylsulfanyl)ethyl]indol-2-yl]methanamine.
| Compound Name | [1-[2-(trifluoromethylsulfanyl)ethyl]indol-2-yl]methanamine |
|---|---|
| PubChem CID | 116627096 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [1-[2-(trifluoromethylsulfanyl)ethyl]indol-2-yl]methanamine |
| SMILES | NCc1cc2ccccc2n1CCSC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2S/c13-12(14,15)18-6-5-17-10(8-16)7-9-3-1-2-4-11(9)17/h1-4,7H,5-6,8,16H2 |
| InChIKey | MZHNFJDNKJYSJE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |