C22H36N6O4 — CID 146535745
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide (PubChem CID 146535745) has the molecular formula C22H36N6O4 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide.
| Compound Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 146535745 |
| Molecular Formula | C22H36N6O4 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)NCC(=O)NCCOCCOCCN |
| InChI | InChI=1S/C22H36N6O4/c1-24-27(2)17-19-15-18-5-3-4-6-20(18)28(19)10-7-21(29)26-16-22(30)25-9-12-32-14-13-31-11-8-23/h3-6,15,24H,7-14,16-17,23H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | MHYALRCXSZGBAA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|