C25H40N6O6 — CID 118121238
(4S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-oxopentanoic acid (PubChem CID 118121238) has the molecular formula C25H40N6O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is (4S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118121238 |
| Molecular Formula | C25H40N6O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (4S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-oxopentanoic acid |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)N[C@@H](CCC(=O)O)C(=O)NCCOCCOCCN |
| InChI | InChI=1S/C25H40N6O6/c1-27-30(2)18-20-17-19-5-3-4-6-22(19)31(20)12-9-23(32)29-21(7-8-24(33)34)25(35)28-11-14-37-16-15-36-13-10-26/h3-6,17,21,27H,7-16,18,26H2,1-2H3,(H,28,35)(H,29,32)(H,33,34)/t21-/m0/s1 |
| InChIKey | KHIXAARHUDSKAH-NRFANRHFSA-N |
| XLogP | 0.06 |
| TPSA | 160.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|