C26H41N5O5 — CID 138744679
3-[2-[2-[[1-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoyl]piperidin-4-yl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 138744679) has the molecular formula C26H41N5O5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 3-[2-[2-[[1-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoyl]piperidin-4-yl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[[1-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoyl]piperidin-4-yl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 138744679 |
| Molecular Formula | C26H41N5O5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 3-[2-[2-[[1-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoyl]piperidin-4-yl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)N1CCC(NCCOCCOCCC(=O)O)CC1 |
| InChI | InChI=1S/C26H41N5O5/c1-27-29(2)20-23-19-21-5-3-4-6-24(21)31(23)14-9-25(32)30-12-7-22(8-13-30)28-11-16-36-18-17-35-15-10-26(33)34/h3-6,19,22,27-28H,7-18,20H2,1-2H3,(H,33,34) |
| InChIKey | XQZMCMVWJPCIJN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|