C30H46N6O8 — CID 175745631
4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-[2-[2-[3-[methyl(1-oxopropan-2-yl)amino]-3-oxopropoxy]ethoxy]ethylamino]-5-oxopentanoic acid (PubChem CID 175745631) has the molecular formula C30H46N6O8 and a molecular weight of 618.73 g/mol. Its IUPAC name is 4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-[2-[2-[3-[methyl(1-oxopropan-2-yl)amino]-3-oxopropoxy]ethoxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | 4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-[2-[2-[3-[methyl(1-oxopropan-2-yl)amino]-3-oxopropoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175745631 |
| Molecular Formula | C30H46N6O8 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | 4-[3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanoylamino]-5-[2-[2-[3-[methyl(1-oxopropan-2-yl)amino]-3-oxopropoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)NC(CCC(=O)O)C(=O)NCCOCCOCCC(=O)N(C)C(C)C=O |
| InChI | InChI=1S/C30H46N6O8/c1-22(21-37)35(4)28(39)12-15-43-17-18-44-16-13-32-30(42)25(9-10-29(40)41)33-27(38)11-14-36-24(20-34(3)31-2)19-23-7-5-6-8-26(23)36/h5-8,19,21-22,25,31H,9-18,20H2,1-4H3,(H,32,42)(H,33,38)(H,40,41) |
| InChIKey | MIWHSWZOFPGYOD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|