C29H47BN6O8S — CID 174007402
CID 174007402 (PubChem CID 174007402) has the molecular formula C29H47BN6O8S and a molecular weight of 650.61 g/mol.
| Compound Name | CID 174007402 |
|---|---|
| PubChem CID | 174007402 |
| Molecular Formula | C29H47BN6O8S |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | — |
| SMILES | [B]CCCCCC(=O)NCCOCCOCCNC(=O)[C@H](CS(=O)(=O)O)NC(=O)CCn1c(CN(C)NC)cc2ccccc21 |
| InChI | InChI=1S/C29H47BN6O8S/c1-31-35(2)21-24-20-23-8-5-6-9-26(23)36(24)15-11-28(38)34-25(22-45(40,41)42)29(39)33-14-17-44-19-18-43-16-13-32-27(37)10-4-3-7-12-30/h5-6,8-9,20,25,31H,3-4,7,10-19,21-22H2,1-2H3,(H,32,37)(H,33,39)(H,34,38)(H,40,41,42)/t25-/m0/s1 |
| InChIKey | PPKZUCVNYDICMU-VWLOTQADSA-N |
| XLogP | 0.38 |
| TPSA | 180.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|