C20H31N5O2 — CID 118109462
N-(5-formamidopentyl)-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide (PubChem CID 118109462) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(5-formamidopentyl)-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide.
| Compound Name | N-(5-formamidopentyl)-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 118109462 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-(5-formamidopentyl)-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)NCCCCCNC=O |
| InChI | InChI=1S/C20H31N5O2/c1-21-24(2)15-18-14-17-8-4-5-9-19(17)25(18)13-10-20(27)23-12-7-3-6-11-22-16-26/h4-5,8-9,14,16,21H,3,6-7,10-13,15H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | FSNPBEDITKAMHC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|