C22H35N7O4 — CID 146673229
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide (PubChem CID 146673229) has the molecular formula C22H35N7O4 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 146673229 |
| Molecular Formula | C22H35N7O4 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]propanamide |
| SMILES | CNN(C)Cc1cc2ccccc2n1CCC(=O)NCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H35N7O4/c1-24-28(2)18-20-17-19-5-3-4-6-21(19)29(20)10-7-22(30)25-8-11-31-13-15-33-16-14-32-12-9-26-27-23/h3-6,17,24H,7-16,18H2,1-2H3,(H,25,30) |
| InChIKey | OSIXECKPIWNSBQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|