C30H51N5 — CID 146227897
N-dec-1-en-2-yl-N'-[4-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]but-1-en-2-yl]pentane-1,5-diamine (PubChem CID 146227897) has the molecular formula C30H51N5 and a molecular weight of 481.77 g/mol. Its IUPAC name is N-dec-1-en-2-yl-N'-[4-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]but-1-en-2-yl]pentane-1,5-diamine.
| Compound Name | N-dec-1-en-2-yl-N'-[4-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]but-1-en-2-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 146227897 |
| Molecular Formula | C30H51N5 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.41 |
| IUPAC Name | N-dec-1-en-2-yl-N'-[4-[2-[[methyl(methylamino)amino]methyl]indol-1-yl]but-1-en-2-yl]pentane-1,5-diamine |
| SMILES | C=C(CCCCCCCC)NCCCCCNC(=C)CCn1c(CN(C)NC)cc2ccccc21 |
| InChI | InChI=1S/C30H51N5/c1-6-7-8-9-10-12-17-26(2)32-21-15-11-16-22-33-27(3)20-23-35-29(25-34(5)31-4)24-28-18-13-14-19-30(28)35/h13-14,18-19,24,31-33H,2-3,6-12,15-17,20-23,25H2,1,4-5H3 |
| InChIKey | JXUYWEFDNKWFSY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 44.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|