C27H42N4O8S — CID 157108951
(2R)-2-[3-[2-[[ethyl(methyl)amino]methyl]indol-1-yl]propanoylamino]-3-oxo-3-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]propane-1-sulfonic acid (PubChem CID 157108951) has the molecular formula C27H42N4O8S and a molecular weight of 582.72 g/mol. Its IUPAC name is (2R)-2-[3-[2-[[ethyl(methyl)amino]methyl]indol-1-yl]propanoylamino]-3-oxo-3-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]propane-1-sulfonic acid.
| Compound Name | (2R)-2-[3-[2-[[ethyl(methyl)amino]methyl]indol-1-yl]propanoylamino]-3-oxo-3-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 157108951 |
| Molecular Formula | C27H42N4O8S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (2R)-2-[3-[2-[[ethyl(methyl)amino]methyl]indol-1-yl]propanoylamino]-3-oxo-3-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]propane-1-sulfonic acid |
| SMILES | CCN(C)Cc1cc2ccccc2n1CCC(=O)N[C@@H](CS(=O)(=O)O)C(=O)NCCOCCOCCCC(C)=O |
| InChI | InChI=1S/C27H42N4O8S/c1-4-30(3)19-23-18-22-9-5-6-10-25(22)31(23)13-11-26(33)29-24(20-40(35,36)37)27(34)28-12-15-39-17-16-38-14-7-8-21(2)32/h5-6,9-10,18,24H,4,7-8,11-17,19-20H2,1-3H3,(H,28,34)(H,29,33)(H,35,36,37)/t24-/m0/s1 |
| InChIKey | AGPVVZQXLQUODQ-DEOSSOPVSA-N |
| XLogP | 1.37 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|