About octanedioic acid
octanedioic acid (PubChem CID 10457) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is octanedioic acid.
Molecular Properties
| Compound Name | octanedioic acid |
| PubChem CID | 10457 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | octanedioic acid |
| SMILES | O=C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| InChIKey | TYFQFVWCELRYAO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octanedioic acid?
The IUPAC name of octanedioic acid (CID 10457) is octanedioic acid.
What is the SMILES notation for octanedioic acid?
The canonical SMILES for octanedioic acid is O=C(O)CCCCCCC(=O)O.
What is the InChIKey of octanedioic acid?
The InChIKey is TYFQFVWCELRYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12).
What are the key properties of octanedioic acid?
octanedioic acid has a molecular weight of 174.20 g/mol, XLogP of 1.50, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octanedioic acid is sourced from PubChem (CID 10457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).