C8H13NO4S — CID 104570081
2-[2-[(3-hydroxycyclobutyl)amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104570081) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-[2-[(3-hydroxycyclobutyl)amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(3-hydroxycyclobutyl)amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104570081 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-[2-[(3-hydroxycyclobutyl)amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NC1CC(O)C1 |
| InChI | InChI=1S/C8H13NO4S/c10-6-1-5(2-6)9-7(11)3-14-4-8(12)13/h5-6,10H,1-4H2,(H,9,11)(H,12,13) |
| InChIKey | FNQGCWKELBGTMN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |