C8H10N2O2S — CID 104570637
3-(3,5-dioxothiomorpholin-4-yl)butanenitrile (PubChem CID 104570637) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 3-(3,5-dioxothiomorpholin-4-yl)butanenitrile.
| Compound Name | 3-(3,5-dioxothiomorpholin-4-yl)butanenitrile |
|---|---|
| PubChem CID | 104570637 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-(3,5-dioxothiomorpholin-4-yl)butanenitrile |
| SMILES | CC(CC#N)N1C(=O)CSCC1=O |
| InChI | InChI=1S/C8H10N2O2S/c1-6(2-3-9)10-7(11)4-13-5-8(10)12/h6H,2,4-5H2,1H3 |
| InChIKey | FOYCRDVZOVLFAK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|