C7H11NO3S — CID 104570938
4-[(2R)-1-hydroxypropan-2-yl]thiomorpholine-3,5-dione (PubChem CID 104570938) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 4-[(2R)-1-hydroxypropan-2-yl]thiomorpholine-3,5-dione.
| Compound Name | 4-[(2R)-1-hydroxypropan-2-yl]thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 104570938 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 4-[(2R)-1-hydroxypropan-2-yl]thiomorpholine-3,5-dione |
| SMILES | C[C@H](CO)N1C(=O)CSCC1=O |
| InChI | InChI=1S/C7H11NO3S/c1-5(2-9)8-6(10)3-12-4-7(8)11/h5,9H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | XQCDAFVRDXZJFW-RXMQYKEDSA-N |
| XLogP | -0.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|