C9H13NO3S — CID 104570913
4-(2-cyclopropyl-2-hydroxyethyl)thiomorpholine-3,5-dione (PubChem CID 104570913) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(2-cyclopropyl-2-hydroxyethyl)thiomorpholine-3,5-dione.
| Compound Name | 4-(2-cyclopropyl-2-hydroxyethyl)thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 104570913 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(2-cyclopropyl-2-hydroxyethyl)thiomorpholine-3,5-dione |
| SMILES | O=C1CSCC(=O)N1CC(O)C1CC1 |
| InChI | InChI=1S/C9H13NO3S/c11-7(6-1-2-6)3-10-8(12)4-14-5-9(10)13/h6-7,11H,1-5H2 |
| InChIKey | XKRARDITKVLYGD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|