C11H17NO4 — CID 104753189
4-(2-cyclopentyl-2-hydroxyethyl)morpholine-3,5-dione (PubChem CID 104753189) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-hydroxyethyl)morpholine-3,5-dione.
| Compound Name | 4-(2-cyclopentyl-2-hydroxyethyl)morpholine-3,5-dione |
|---|---|
| PubChem CID | 104753189 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(2-cyclopentyl-2-hydroxyethyl)morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1CC(O)C1CCCC1 |
| InChI | InChI=1S/C11H17NO4/c13-9(8-3-1-2-4-8)5-12-10(14)6-16-7-11(12)15/h8-9,13H,1-7H2 |
| InChIKey | ZFINGDYMVZEOGW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|