C15H19NO3 — CID 104753134
4-(2-cyclopentyl-2-hydroxyethyl)-1,4-benzoxazin-3-one (PubChem CID 104753134) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-hydroxyethyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(2-cyclopentyl-2-hydroxyethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 104753134 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-(2-cyclopentyl-2-hydroxyethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CC(O)C1CCCC1 |
| InChI | InChI=1S/C15H19NO3/c17-13(11-5-1-2-6-11)9-16-12-7-3-4-8-14(12)19-10-15(16)18/h3-4,7-8,11,13,17H,1-2,5-6,9-10H2 |
| InChIKey | HVYUKDIFAASBEJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |