C7H12N2O2S — CID 104570982
4-[2-(methylamino)ethyl]thiomorpholine-3,5-dione (PubChem CID 104570982) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 4-[2-(methylamino)ethyl]thiomorpholine-3,5-dione.
| Compound Name | 4-[2-(methylamino)ethyl]thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 104570982 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4-[2-(methylamino)ethyl]thiomorpholine-3,5-dione |
| SMILES | CNCCN1C(=O)CSCC1=O |
| InChI | InChI=1S/C7H12N2O2S/c1-8-2-3-9-6(10)4-12-5-7(9)11/h8H,2-5H2,1H3 |
| InChIKey | IHZHXDRLLDCZBY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|