C6H10N2OS — CID 164644186
2-[2-(methylamino)ethyl]-1,3-thiazol-4-one (PubChem CID 164644186) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-[2-(methylamino)ethyl]-1,3-thiazol-4-one.
| Compound Name | 2-[2-(methylamino)ethyl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 164644186 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-[2-(methylamino)ethyl]-1,3-thiazol-4-one |
| SMILES | CNCCC1=NC(=O)CS1 |
| InChI | InChI=1S/C6H10N2OS/c1-7-3-2-6-8-5(9)4-10-6/h7H,2-4H2,1H3 |
| InChIKey | IFUFGCCDIOTBFG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |