2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid

C14H15NO2S — CID 104571505

IUPAC2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid
SMILESCc1nc(C(Cc2ccccc2)C(=O)O)sc1C
InChIInChI=1S/C14H15NO2S/c1-9-10(2)18-13(15-9)12(14(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8H2,1-2H3,(H,16,17)
InChIKeyJBPLQGBSDPSIDC-UHFFFAOYSA-N
MW261.35 g/mol
LogP3.17
Rot. Bonds4

About 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid

2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid (PubChem CID 104571505) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid.

Molecular Properties

Compound Name2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid
PubChem CID104571505
Molecular FormulaC14H15NO2S
Molecular Weight261.35 g/mol
Exact Mass261.08
IUPAC Name2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid
SMILESCc1nc(C(Cc2ccccc2)C(=O)O)sc1C
InChIInChI=1S/C14H15NO2S/c1-9-10(2)18-13(15-9)12(14(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8H2,1-2H3,(H,16,17)
InChIKeyJBPLQGBSDPSIDC-UHFFFAOYSA-N
XLogP3.17
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.35
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid?
The IUPAC name of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid (CID 104571505) is 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid.
What is the SMILES notation for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid?
The canonical SMILES for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid is Cc1nc(C(Cc2ccccc2)C(=O)O)sc1C.
What is the InChIKey of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid?
The InChIKey is JBPLQGBSDPSIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c1-9-10(2)18-13(15-9)12(14(16)17)8-11-6-4-3-5-7-11/h3-7,12H,8H2,1-2H3,(H,16,17).
What are the key properties of 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid?
2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid has a molecular weight of 261.35 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenylpropanoic acid is sourced from PubChem (CID 104571505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).