C13H15NS — CID 83382597
4,5-dimethyl-2-(1-phenylethyl)-1,3-thiazole (PubChem CID 83382597) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1-phenylethyl)-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-(1-phenylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83382597 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4,5-dimethyl-2-(1-phenylethyl)-1,3-thiazole |
| SMILES | Cc1nc(C(C)c2ccccc2)sc1C |
| InChI | InChI=1S/C13H15NS/c1-9(12-7-5-4-6-8-12)13-14-10(2)11(3)15-13/h4-9H,1-3H3 |
| InChIKey | DIAQSXUZJVVEHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |